CAS 3115-68-2 appears in our catalog under these names: Tetrabutylphosphonium Bromide, >95% (HPLC), Tetrabutylphosphonium bromide, Tetra-n-butylphosphonium bromide, 99% , Tetra-n-butylphosphonium bromide, Tetrabutylphosphonium Bromide, >99.0%(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 500g, 25g, 0,5kg, 5g.
Tetrabutylphosphanium bromide (CAS 3115-68-2) is a chemical compound with the molecular formula C16H36BrP and a molecular weight of 339.33 g/mol. IUPAC name: tetrabutylphosphanium bromide. InChIKey: RKHXQBLJXBGEKF-UHFFFAOYSA-M.
| Molecular formula | C16H36BrP |
|---|---|
| Molecular weight | 339.33 g/mol |
| IUPAC name | tetrabutylphosphanium bromide |
| InChIKey | RKHXQBLJXBGEKF-UHFFFAOYSA-M |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.[Br-] |
Computed by PubChem (NCBI)