CAS 31162-13-7 appears in our catalog under these names: 2-Azidobenzoic Acid, 2-Azidobenzoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.
2-azidobenzoic acid (CAS 31162-13-7) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 2-azidobenzoic acid. InChIKey: JCBWQNLTYXTHBZ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2-azidobenzoic acid |
| InChIKey | JCBWQNLTYXTHBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)