CAS 31164-27-9 appears in our catalog under these names: 3-Nitro-1h-indazole, 95%, 3-Nitro-1H-indazole, 97%, 3–Nitro–1H–indazole, 3-Nitro-1H-indazole, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-nitro-2H-indazole (CAS 31164-27-9) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-nitro-2H-indazole. InChIKey: OWIRCRREDNEXTA-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-nitro-2H-indazole |
| InChIKey | OWIRCRREDNEXTA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)