Products 311770-26-0
CAS 311770-26-0 is the registry number for KRP-101. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[3-[[4-(4-fluorophenoxy)phenyl]methylcarbamoyl]-4-methoxyphenyl]methyl]butanoic acid (CAS 311770-26-0) is a chemical compound with the molecular formula C26H26FNO5 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-2-[[3-[[4-(4-fluorophenoxy)phenyl]methylcarbamoyl]-4-methoxyphenyl]methyl]butanoic acid. InChIKey: VRHOBXXCNBZJRX-IBGZPJMESA-N.
| Molecular formula | C26H26FNO5 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-2-[[3-[[4-(4-fluorophenoxy)phenyl]methylcarbamoyl]-4-methoxyphenyl]methyl]butanoic acid |
| InChIKey | VRHOBXXCNBZJRX-IBGZPJMESA-N |
| SMILES | CC[C@@H](CC1=CC(=C(C=C1)OC)C(=O)NCC2=CC=C(C=C2)OC3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)