CAS 3118-16-9 appears in our catalog under these names: 9-Azatricyclo(6.2.2.0,2,7)dodeca-2,4,6-trien-10-one, 95%, 9-Azatricyclo(6.2.2.0,2,7)dodeca-2,4,6-trien-10-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one (CAS 3118-16-9) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one. InChIKey: BPBPNUGGTKXXAM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one |
| InChIKey | BPBPNUGGTKXXAM-UHFFFAOYSA-N |
| SMILES | C1CC2C3=CC=CC=C3C1C(=O)N2 |
Computed by PubChem (NCBI)