CAS 31181-64-3 appears in our catalog under these names: 5-Bromo-2-methylpyridine n-oxide, 98%, 5–Bromo–2–methylpyridine N–oxide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
5-bromo-2-methyl-1-oxidopyridin-1-ium (CAS 31181-64-3) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 188.02 g/mol. IUPAC name: 5-bromo-2-methyl-1-oxidopyridin-1-ium. InChIKey: NEEHOROWKICRQK-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | 5-bromo-2-methyl-1-oxidopyridin-1-ium |
| InChIKey | NEEHOROWKICRQK-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=C(C=C1)Br)[O-] |
Computed by PubChem (NCBI)