CAS 3119-15-1 appears in our catalog under these names: 3-Amino-2,4,6-triiodobenzoic Acid, 3-Amino-2,4,6-triiodobenzoic acid, 99% (dry wt.), water <4% , 3-Amino-2,4,6-triiodobenzoic Acid, 98%, 98%, 3-Amino-2,4,6-triiodobenzoic acid, 98%. Offered by: Mikromol, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 4x25mg, 25mg, 5g, 25g, 0,005kg, 0,01kg, 1g, 10g.
3-amino-2,4,6-triiodobenzoic acid (CAS 3119-15-1) is a chemical compound with the molecular formula C7H4I3NO2 and a molecular weight of 514.83 g/mol. IUPAC name: 3-amino-2,4,6-triiodobenzoic acid. InChIKey: QMQFFHSJUJDRPG-UHFFFAOYSA-N.
| Molecular formula | C7H4I3NO2 |
|---|---|
| Molecular weight | 514.83 g/mol |
| IUPAC name | 3-amino-2,4,6-triiodobenzoic acid |
| InChIKey | QMQFFHSJUJDRPG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1I)N)I)C(=O)O)I |
Computed by PubChem (NCBI)