CAS 3119-64-0 appears in our catalog under these names: 4,4'-Methylenebis(benzenesulfonyl chloride), 95%, 4,4-Methylenebis(benzenesulfonylchloridE), 95%, 4,4'–Methylenebis(benzenesulfonyl Chloride), 4,4'-Methylenebis(benzenesulfonyl Chloride), >95.0%(T). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 250mg, 1g.
4-[(4-chlorosulfonylphenyl)methyl]benzenesulfonyl chloride (CAS 3119-64-0) is a chemical compound with the molecular formula C13H10Cl2O4S2 and a molecular weight of 365.3 g/mol. IUPAC name: 4-[(4-chlorosulfonylphenyl)methyl]benzenesulfonyl chloride. InChIKey: YKMMQCFZCFAHOU-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O4S2 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 4-[(4-chlorosulfonylphenyl)methyl]benzenesulfonyl chloride |
| InChIKey | YKMMQCFZCFAHOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)