CAS 312-66-3 appears in our catalog under these names: 2,2,3,3,4,4,4-Heptafluorobutyl p-toluenesulfonate, 95%, 2,2,3,3,4,4,4-Heptafluorobutyl 4-methylbenzenesulfonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
2,2,3,3,4,4,4-heptafluorobutyl 4-methylbenzenesulfonate (CAS 312-66-3) is a chemical compound with the molecular formula C11H9F7O3S and a molecular weight of 354.24 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluorobutyl 4-methylbenzenesulfonate. InChIKey: NVBRUIASHQWABC-UHFFFAOYSA-N.
| Molecular formula | C11H9F7O3S |
|---|---|
| Molecular weight | 354.24 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluorobutyl 4-methylbenzenesulfonate |
| InChIKey | NVBRUIASHQWABC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)