Products 31217-72-8

CAS 31217-72-8 is the registry number for 1-Ethyl-3-methyl-2,5-dihydro-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-ethyl-3-methylpyrrole-2,5-dione (CAS 31217-72-8) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: 1-ethyl-3-methylpyrrole-2,5-dione. InChIKey: NKHIHGVHWGKXMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO2
Molecular weight139.15 g/mol
IUPAC name1-ethyl-3-methylpyrrole-2,5-dione
InChIKeyNKHIHGVHWGKXMQ-UHFFFAOYSA-N
SMILESCCN1C(=O)C=C(C1=O)C

Computed by PubChem (NCBI)