Products 312274-98-9

CAS 312274-98-9 is the registry number for 3-(4-Bromo-phenylsulfamoyl)-4-methoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-[(4-bromophenyl)sulfamoyl]-4-methoxybenzoic acid (CAS 312274-98-9) is a chemical compound with the molecular formula C14H12BrNO5S and a molecular weight of 386.22 g/mol. IUPAC name: 3-[(4-bromophenyl)sulfamoyl]-4-methoxybenzoic acid. InChIKey: MSNNECLBCSCZBO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12BrNO5S
Molecular weight386.22 g/mol
IUPAC name3-[(4-bromophenyl)sulfamoyl]-4-methoxybenzoic acid
InChIKeyMSNNECLBCSCZBO-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NC2=CC=C(C=C2)Br

Computed by PubChem (NCBI)