CAS 31238-57-0 appears in our catalog under these names: Diphenyl((phenylthio)methyl)phosphine oxide, Diphenyl((phenylthio)methyl)phosphine oxide 95%, Diphenyl((phenylthio)methyl)phosphine oxide, 95%, 95%, DIPHENYL((PHENYLTHIO)METHYL)PHOSPHINE OXIDE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[phenyl(phenylsulfanylmethyl)phosphoryl]benzene (CAS 31238-57-0) is a chemical compound with the molecular formula C19H17OPS and a molecular weight of 324.4 g/mol. IUPAC name: [phenyl(phenylsulfanylmethyl)phosphoryl]benzene. InChIKey: FSHUUGJBSQZQGW-UHFFFAOYSA-N.
| Molecular formula | C19H17OPS |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | [phenyl(phenylsulfanylmethyl)phosphoryl]benzene |
| InChIKey | FSHUUGJBSQZQGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(CSC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)