CAS 31248-39-2 appears in our catalog under these names: Platinum(II) octaethylporphine, 95%, Ptoep, 95%, Poly(9,9-di-n -dodecylfluorenyl-2,7-diyl), Platinum octaethylporphyrin Dye content, PLATINUM(II) 2,3,7,8,12,13,17,18-OCTAET&. Offered by: Lumtec, Combi-blocks, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 0.5g, 1g, 250mg, 100mg, On request, 25mg.
2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;platinum(2+) (CAS 31248-39-2) is a chemical compound with the molecular formula C36H44N4Pt and a molecular weight of 727.8 g/mol. IUPAC name: 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;platinum(2+). InChIKey: WAODGUVBNLMTSF-UHFFFAOYSA-N.
| Molecular formula | C36H44N4Pt |
|---|---|
| Molecular weight | 727.8 g/mol |
| IUPAC name | 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;platinum(2+) |
| InChIKey | WAODGUVBNLMTSF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)CC)C(=C3CC)CC)CC.[Pt+2] |
Computed by PubChem (NCBI)