CAS 3125-07-3 appears in our catalog under these names: Tetraoctylammonium chloride, 95-<97%, Tetraoctylammonium chloride, ≥97-<99%, TETRAOCTYLAMMONIUM CHLORIDE, >=97.0%, Tetraoctylammonium Chloride, 95%+(NMR),RG, 95%+(NMR),RG. Offered by: Hoffman Fine Chemicals, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 5G, 100mg, 250mg.
Tetraoctylazanium chloride (CAS 3125-07-3) is a chemical compound with the molecular formula C32H68ClN and a molecular weight of 502.3 g/mol. IUPAC name: tetraoctylazanium chloride. InChIKey: SNNIPOQLGBPXPS-UHFFFAOYSA-M.
| Molecular formula | C32H68ClN |
|---|---|
| Molecular weight | 502.3 g/mol |
| IUPAC name | tetraoctylazanium chloride |
| InChIKey | SNNIPOQLGBPXPS-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Cl-] |
Computed by PubChem (NCBI)