CAS 312531-18-3 appears in our catalog under these names: [2-(2-Benzylphenoxy)-5-(trifluoromethyl)phenyl]amine hydrochloride, 95%, (2-(2-benzylphenoxy)-5-(trifluoromethyl)phenyl)amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2-benzylphenoxy)-5-(trifluoromethyl)aniline (CAS 312531-18-3) is a chemical compound with the molecular formula C20H16F3NO and a molecular weight of 343.3 g/mol. IUPAC name: 2-(2-benzylphenoxy)-5-(trifluoromethyl)aniline. InChIKey: DUVWLKNTAKUSOV-UHFFFAOYSA-N.
| Molecular formula | C20H16F3NO |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 2-(2-benzylphenoxy)-5-(trifluoromethyl)aniline |
| InChIKey | DUVWLKNTAKUSOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=CC=C2OC3=C(C=C(C=C3)C(F)(F)F)N |
Computed by PubChem (NCBI)