CAS 312588-66-2 is the registry number for 4-(tert-butyl)phenyl (4-(diphenylmethyl)piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(4-benzhydrylpiperazin-1-yl)-(4-tert-butylphenyl)methanone (CAS 312588-66-2) is a chemical compound with the molecular formula C28H32N2O and a molecular weight of 412.6 g/mol. IUPAC name: (4-benzhydrylpiperazin-1-yl)-(4-tert-butylphenyl)methanone. InChIKey: QXYOWGBDYOBWFH-UHFFFAOYSA-N.
| Molecular formula | C28H32N2O |
|---|---|
| Molecular weight | 412.6 g/mol |
| IUPAC name | (4-benzhydrylpiperazin-1-yl)-(4-tert-butylphenyl)methanone |
| InChIKey | QXYOWGBDYOBWFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)N2CCN(CC2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)