CAS 31262-82-5 is the registry number for Estazolam Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
8-chloro-6-phenyl-2,4-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-one (CAS 31262-82-5) is a chemical compound with the molecular formula C16H11ClN4O and a molecular weight of 310.74 g/mol. IUPAC name: 8-chloro-6-phenyl-2,4-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-one. InChIKey: BKXMIHOSZZYXDH-UHFFFAOYSA-N.
| Molecular formula | C16H11ClN4O |
|---|---|
| Molecular weight | 310.74 g/mol |
| IUPAC name | 8-chloro-6-phenyl-2,4-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-one |
| InChIKey | BKXMIHOSZZYXDH-UHFFFAOYSA-N |
| SMILES | C1C2=NNC(=O)N2C3=C(C=C(C=C3)Cl)C(=N1)C4=CC=CC=C4 |
Computed by PubChem (NCBI)