Products 312623-77-1
CAS 312623-77-1 is the registry number for Bismuth subgallate hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 500g, 5g, 25g, 100g.
CAS 312623-77-1 identifies a chemical compound with the molecular formula C7H8BiO7 and a molecular weight of 413.11 g/mol. InChIKey: QYRZNUWUKYCZNU-UHFFFAOYSA-L.
| Molecular formula | C7H8BiO7 |
|---|---|
| Molecular weight | 413.11 g/mol |
| InChIKey | QYRZNUWUKYCZNU-UHFFFAOYSA-L |
| SMILES | C1=C(C=C2C(=C1O)O[Bi]O2)C(=O)O.O.O |
Computed by PubChem (NCBI)
Synonyms:
Bismuth subgallate hydrate, Bismuth(III) gallate basic hydrate, 2,7-dihydroxybenzo[d][1,3,2]dioxabismole-5-carboxylic acid xhydrate, Dermatol puder, Bismuth Gallate Hydrate (Technical Grade), starbld0008157, 4-hydroxy-1,3,2$l^{2}, Bismuth(III) gallate basic hydrate, 52.0-57.0%, 6-Carboxy-4-hydroxy-2H-1,3,2-benzodioxabismol-2-yl--water (1/1), 2,7-Dihydroxy-2H-1,3,2-benzodioxabismole-5-carboxylic acid--water (1/1)