CAS 312623-83-9 is the registry number for Sodium fumarate-2,3-13C2, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Disodium;(E)-(2,3-13C2)but-2-enedioate (CAS 312623-83-9) is a chemical compound with the molecular formula C4H2Na2O4 and a molecular weight of 162.02 g/mol. IUPAC name: disodium;(E)-(2,3-13C2)but-2-enedioate. InChIKey: MSJMDZAOKORVFC-CRQBDLPISA-L.
| Molecular formula | C4H2Na2O4 |
|---|---|
| Molecular weight | 162.02 g/mol |
| IUPAC name | disodium;(E)-(2,3-13C2)but-2-enedioate |
| InChIKey | MSJMDZAOKORVFC-CRQBDLPISA-L |
| SMILES | [13CH](=[13CH]/C(=O)[O-])\C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)