CAS 312624-13-8 appears in our catalog under these names: 3–Chlorobenzylzinc chloride, 3-CHLOROBENZYLZINC CHLORIDE, 0.5M SOLUT&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 50ml.
1-chloro-3-methanidylbenzene;chlorozinc(1+) (CAS 312624-13-8) is a chemical compound with the molecular formula C7H6Cl2Zn and a molecular weight of 226.4 g/mol. IUPAC name: 1-chloro-3-methanidylbenzene;chlorozinc(1+). InChIKey: ICUOPRHOUZCMIM-UHFFFAOYSA-M.
| Molecular formula | C7H6Cl2Zn |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 1-chloro-3-methanidylbenzene;chlorozinc(1+) |
| InChIKey | ICUOPRHOUZCMIM-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CC(=CC=C1)Cl.Cl[Zn+] |
Computed by PubChem (NCBI)