CAS 312624-15-0 appears in our catalog under these names: 1-Adamantylzinc bromide, 0.5M in THF, packaged under Argon i, 1-ADAMANTYLZINC BROMIDE, 0.5M SOLUTION &. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 50ml.
Adamantan-1-ide;bromozinc(1+) (CAS 312624-15-0) is a chemical compound with the molecular formula C10H15BrZn and a molecular weight of 280.5 g/mol. IUPAC name: adamantan-1-ide;bromozinc(1+). InChIKey: PTWVHBHYYPLVCD-UHFFFAOYSA-M.
| Molecular formula | C10H15BrZn |
|---|---|
| Molecular weight | 280.5 g/mol |
| IUPAC name | adamantan-1-ide;bromozinc(1+) |
| InChIKey | PTWVHBHYYPLVCD-UHFFFAOYSA-M |
| SMILES | C1C2CC3CC1C[C-](C2)C3.[Zn+]Br |
Computed by PubChem (NCBI)