CAS 31263-89-5 appears in our catalog under these names: 3-methyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonamide, 95%, 3-Methyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide (CAS 31263-89-5) is a chemical compound with the molecular formula C8H8N2O3S2 and a molecular weight of 244.3 g/mol. IUPAC name: 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide. InChIKey: UDXNNQHAXIMTFL-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3S2 |
|---|---|
| Molecular weight | 244.3 g/mol |
| IUPAC name | 3-methyl-2-oxo-1,3-benzothiazole-6-sulfonamide |
| InChIKey | UDXNNQHAXIMTFL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)N)SC1=O |
Computed by PubChem (NCBI)