CAS 312693-07-5 appears in our catalog under these names: 4–Fluorobenzylzinc chloride, 4-FLUOROBENZYLZINC CHLORIDE, 0.5M SOLUT&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 50ml.
Chlorozinc(1+);1-fluoro-4-methanidylbenzene (CAS 312693-07-5) is a chemical compound with the molecular formula C7H6ClFZn and a molecular weight of 210.0 g/mol. IUPAC name: chlorozinc(1+);1-fluoro-4-methanidylbenzene. InChIKey: HEXMIUITECMJJV-UHFFFAOYSA-M.
| Molecular formula | C7H6ClFZn |
|---|---|
| Molecular weight | 210.0 g/mol |
| IUPAC name | chlorozinc(1+);1-fluoro-4-methanidylbenzene |
| InChIKey | HEXMIUITECMJJV-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CC=C(C=C1)F.Cl[Zn+] |
Computed by PubChem (NCBI)