CAS 312693-16-6 appears in our catalog under these names: 3–METHOXYBENZYLZINC CHLORIDE, 3-METHOXYBENZYLZINC CHLORIDE, 0.5M &. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 50ml.
Chlorozinc(1+);1-methanidyl-3-methoxybenzene (CAS 312693-16-6) is a chemical compound with the molecular formula C8H9ClOZn and a molecular weight of 222.0 g/mol. IUPAC name: chlorozinc(1+);1-methanidyl-3-methoxybenzene. InChIKey: MRTOLABRGUSXMD-UHFFFAOYSA-M.
| Molecular formula | C8H9ClOZn |
|---|---|
| Molecular weight | 222.0 g/mol |
| IUPAC name | chlorozinc(1+);1-methanidyl-3-methoxybenzene |
| InChIKey | MRTOLABRGUSXMD-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC(=C1)[CH2-].Cl[Zn+] |
Computed by PubChem (NCBI)