CAS 312693-21-3 appears in our catalog under these names: 4–Methylbenzylzinc chloride solution, 4-METHYLBENZYLZINC CHLORIDE, 0.5M SOLUT&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 50ml.
Chlorozinc(1+);1-methanidyl-4-methylbenzene (CAS 312693-21-3) is a chemical compound with the molecular formula C8H9ClZn and a molecular weight of 206.0 g/mol. IUPAC name: chlorozinc(1+);1-methanidyl-4-methylbenzene. InChIKey: GEWUULKDXWVRPH-UHFFFAOYSA-M.
| Molecular formula | C8H9ClZn |
|---|---|
| Molecular weight | 206.0 g/mol |
| IUPAC name | chlorozinc(1+);1-methanidyl-4-methylbenzene |
| InChIKey | GEWUULKDXWVRPH-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)[CH2-].Cl[Zn+] |
Computed by PubChem (NCBI)