CAS 312693-78-0 is the registry number for Sodium chloro(tosyl)amide hydrate. Offered by: GLPBio. Available pack sizes: 1g, 2,5g, 5g.
Sodium;chloro-(4-methylphenyl)sulfonylazanide;hydrate (CAS 312693-78-0) is a chemical compound with the molecular formula C7H9ClNNaO3S and a molecular weight of 245.66 g/mol. IUPAC name: sodium;chloro-(4-methylphenyl)sulfonylazanide;hydrate. InChIKey: BXSDMMPOQRECKB-UHFFFAOYSA-N.
| Molecular formula | C7H9ClNNaO3S |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | sodium;chloro-(4-methylphenyl)sulfonylazanide;hydrate |
| InChIKey | BXSDMMPOQRECKB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[N-]Cl.O.[Na+] |
Computed by PubChem (NCBI)