Products 312696-09-6

CAS 312696-09-6 appears in our catalog under these names: Nickel(II) Bromide 2-Methoxyethyl Ether Complex, >98.0%(T), Nickel(II) bromide 2-methoxyethyl ether complex 98%, NICKEL(II) BROMIDE 2-METHOXYETHYL ETHER&, Nickel(II) bromide 2-methoxyethyl ether complex, 98%, 98%, Nickel(II) bromide 2-methoxyethyl ether complex, 95%. Offered by: TCI, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 100g, 250mg.

Structural formula: {0} (CAS {1})

Dibromonickel;1-methoxy-2-(2-methoxyethoxy)ethane (CAS 312696-09-6) is a chemical compound with the molecular formula C6H14Br2NiO3 and a molecular weight of 352.67 g/mol. IUPAC name: dibromonickel;1-methoxy-2-(2-methoxyethoxy)ethane. InChIKey: RRSIMIHTHWYRRA-UHFFFAOYSA-L.

Identity
Molecular formulaC6H14Br2NiO3
Molecular weight352.67 g/mol
IUPAC namedibromonickel;1-methoxy-2-(2-methoxyethoxy)ethane
InChIKeyRRSIMIHTHWYRRA-UHFFFAOYSA-L
SMILESCOCCOCCOC.[Ni](Br)Br

Computed by PubChem (NCBI)