CAS 31281-86-4 is the registry number for 2,3,5-Tri-o-acetyl-8-bromoadenosine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-8-bromopurin-9-yl)oxolan-2-yl]methyl acetate (CAS 31281-86-4) is a chemical compound with the molecular formula C16H18BrN5O7 and a molecular weight of 472.25 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-8-bromopurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: HRCLVNMFELGYPE-SDBHATRESA-N.
| Molecular formula | C16H18BrN5O7 |
|---|---|
| Molecular weight | 472.25 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-8-bromopurin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | HRCLVNMFELGYPE-SDBHATRESA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C3=NC=NC(=C3N=C2Br)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)