CAS 312915-90-5 appears in our catalog under these names: 3-Amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide, 95%, 3–Amino–5–ethyl–4,6–dimethylthieno(2,3–b)pyridine–2–carboxamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CAS 312915-90-5) is a chemical compound with the molecular formula C12H15N3OS and a molecular weight of 249.33 g/mol. IUPAC name: 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: CWKMPZOEUOYQAU-UHFFFAOYSA-N.
| Molecular formula | C12H15N3OS |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | CWKMPZOEUOYQAU-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(N=C1C)SC(=C2N)C(=O)N)C |
Computed by PubChem (NCBI)