Products 312929-49-0
CAS 312929-49-0 is the registry number for A1/A3 AR antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-methoxybenzamide (CAS 312929-49-0) is a chemical compound with the molecular formula C24H18N2O3S and a molecular weight of 414.5 g/mol. IUPAC name: N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-methoxybenzamide. InChIKey: GWTAISADZNYBMN-UHFFFAOYSA-N.
| Molecular formula | C24H18N2O3S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-methoxybenzamide |
| InChIKey | GWTAISADZNYBMN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=NC(=C(S2)C(=O)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)