CAS 312943-99-0 is the registry number for 3,4,5-Trimethoxy-N-(3-(oxazolo[4,5-b]pyridin-2-yl)phenyl)benzamide. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,4,5-trimethoxy-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide (CAS 312943-99-0) is a chemical compound with the molecular formula C22H19N3O5 and a molecular weight of 405.4 g/mol. IUPAC name: 3,4,5-trimethoxy-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide. InChIKey: LJLACXSBCYAOIH-UHFFFAOYSA-N.
| Molecular formula | C22H19N3O5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]benzamide |
| InChIKey | LJLACXSBCYAOIH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)NC2=CC=CC(=C2)C3=NC4=C(O3)C=CC=N4 |
Computed by PubChem (NCBI)