CAS 312946-37-5 appears in our catalog under these names: LDN–27219, LDN-27219, 99+%, LDN-27219/ 99.15% (existing batch purity), LDN-27219 99+%, Ldn-27219, 99+%, 99+%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetohydrazide (CAS 312946-37-5) is a chemical compound with the molecular formula C20H16N4O2S2 and a molecular weight of 408.5 g/mol. IUPAC name: 2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetohydrazide. InChIKey: WLBUICQBNZXIDJ-UHFFFAOYSA-N.
| Molecular formula | C20H16N4O2S2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 2-(4-oxo-3,5-diphenylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetohydrazide |
| InChIKey | WLBUICQBNZXIDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=O)N(C(=N3)SCC(=O)NN)C4=CC=CC=C4 |
Computed by PubChem (NCBI)