CAS 31295-65-5 appears in our catalog under these names: 4-Bromo-5-methyl-3-phenylisoxazole, 95+%, 4-Bromo-5-methyl-3-phenyl-1,2-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-5-methyl-3-phenyl-1,2-oxazole (CAS 31295-65-5) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 4-bromo-5-methyl-3-phenyl-1,2-oxazole. InChIKey: BOAIRCXZUYJGKO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-bromo-5-methyl-3-phenyl-1,2-oxazole |
| InChIKey | BOAIRCXZUYJGKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)