Products 31323-25-8
CAS 31323-25-8 is the registry number for Fluopsin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
Copper bis(N-methyl-N-oxidomethanethioamide) (CAS 31323-25-8) is a chemical compound with the molecular formula C4H8CuN2O2S2 and a molecular weight of 243.8 g/mol. IUPAC name: copper bis(N-methyl-N-oxidomethanethioamide). InChIKey: PGYZQLIUYISMJD-UHFFFAOYSA-N.
| Molecular formula | C4H8CuN2O2S2 |
|---|---|
| Molecular weight | 243.8 g/mol |
| IUPAC name | copper bis(N-methyl-N-oxidomethanethioamide) |
| InChIKey | PGYZQLIUYISMJD-UHFFFAOYSA-N |
| SMILES | CN(C=S)[O-].CN(C=S)[O-].[Cu+2] |
Computed by PubChem (NCBI)
Synonyms:
Fluopin C, Bis(N-methylthioformohydroxamato)copper, Fluopsin C, Antibiotic 4601, Cuprithioformin, Antibiotic YC-73, Antibiotic No. 4601, Copper, bis(N-hydroxy-N-methylmethanethioamidato-O,S), Copper, bis(N-hydroxy-N-methylmethanethioamidato-O,S)-, Copper, bis(N-methylthioformohydroxamato)-