CAS 313241-30-4 appears in our catalog under these names: 6-Bromo-2-(3-hydroxyphenyl)quinoline-4-carboxylic acid, 95%, 6-Bromo-2-(3-hydroxyphenyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-bromo-2-(3-hydroxyphenyl)quinoline-4-carboxylic acid (CAS 313241-30-4) is a chemical compound with the molecular formula C16H10BrNO3 and a molecular weight of 344.16 g/mol. IUPAC name: 6-bromo-2-(3-hydroxyphenyl)quinoline-4-carboxylic acid. InChIKey: QYJSYSNGXIKVGZ-UHFFFAOYSA-N.
| Molecular formula | C16H10BrNO3 |
|---|---|
| Molecular weight | 344.16 g/mol |
| IUPAC name | 6-bromo-2-(3-hydroxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | QYJSYSNGXIKVGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O |
Computed by PubChem (NCBI)