CAS 313268-18-7 appears in our catalog under these names: P7C3-Ome, 95%, P7C3-OMe/ 99.82% (existing batch purity), P7C3–OMe, P7C3-OMe, 1-(3,6-Dibromocarbazol-9-yl)-3-(3-methoxyanilino)propan-2-ol, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 1mg, 50mg, 100mg, 100 mg, 50 mg.
1-(3,6-dibromocarbazol-9-yl)-3-(3-methoxyanilino)propan-2-ol (CAS 313268-18-7) is a chemical compound with the molecular formula C22H20Br2N2O2 and a molecular weight of 504.2 g/mol. IUPAC name: 1-(3,6-dibromocarbazol-9-yl)-3-(3-methoxyanilino)propan-2-ol. InChIKey: LEICNUMXFWNCSJ-UHFFFAOYSA-N.
| Molecular formula | C22H20Br2N2O2 |
|---|---|
| Molecular weight | 504.2 g/mol |
| IUPAC name | 1-(3,6-dibromocarbazol-9-yl)-3-(3-methoxyanilino)propan-2-ol |
| InChIKey | LEICNUMXFWNCSJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NCC(CN2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br)O |
Computed by PubChem (NCBI)