CAS 313398-51-5 appears in our catalog under these names: 6-chloro-4-phenyl-2-(1-piperazinyl)-Quinazoline, 6-Chloro-4-phenyl-2-(piperazin-1-yl)quinazoline. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-4-phenyl-2-piperazin-1-ylquinazoline (CAS 313398-51-5) is a chemical compound with the molecular formula C18H17ClN4 and a molecular weight of 324.8 g/mol. IUPAC name: 6-chloro-4-phenyl-2-piperazin-1-ylquinazoline. InChIKey: UQUXFXRMNTUFQA-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN4 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 6-chloro-4-phenyl-2-piperazin-1-ylquinazoline |
| InChIKey | UQUXFXRMNTUFQA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(C=C(C=C3)Cl)C(=N2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)