CAS 313484-93-4 appears in our catalog under these names: Tetrakis(4–acetylphenyl)methane, Tetrakis(4-acetylphenyl)methane, 97%, 1,1',1'',1'''-(Methanetetrayltetrakis(benzene-4,1-diyl))tetraethanone 97%, 1,1',1'',1'''-(Methanetetrayltetrakis(benzene-4,1-diyl))tetraethanone, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-[4-[tris(4-acetylphenyl)methyl]phenyl]ethanone (CAS 313484-93-4) is a chemical compound with the molecular formula C33H28O4 and a molecular weight of 488.6 g/mol. IUPAC name: 1-[4-[tris(4-acetylphenyl)methyl]phenyl]ethanone. InChIKey: CAFYIOYXMUILEU-UHFFFAOYSA-N.
| Molecular formula | C33H28O4 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | 1-[4-[tris(4-acetylphenyl)methyl]phenyl]ethanone |
| InChIKey | CAFYIOYXMUILEU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C2=CC=C(C=C2)C(=O)C)(C3=CC=C(C=C3)C(=O)C)C4=CC=C(C=C4)C(=O)C |
Computed by PubChem (NCBI)