CAS 313489-71-3 appears in our catalog under these names: LY 517717, LY 517717/ 99.88% (existing batch purity), LY-517717. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg.
N-[(1R)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxo-1-phenylethyl]-1H-indole-6-carboxamide (CAS 313489-71-3) is a chemical compound with the molecular formula C27H33N5O2 and a molecular weight of 459.6 g/mol. IUPAC name: N-[(1R)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxo-1-phenylethyl]-1H-indole-6-carboxamide. InChIKey: VYNKVNDKAOGAAQ-RUZDIDTESA-N.
| Molecular formula | C27H33N5O2 |
|---|---|
| Molecular weight | 459.6 g/mol |
| IUPAC name | N-[(1R)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxo-1-phenylethyl]-1H-indole-6-carboxamide |
| InChIKey | VYNKVNDKAOGAAQ-RUZDIDTESA-N |
| SMILES | CN1CCC(CC1)N2CCN(CC2)C(=O)[C@@H](C3=CC=CC=C3)NC(=O)C4=CC5=C(C=C4)C=CN5 |
Computed by PubChem (NCBI)