Products 313527-11-6
CAS 313527-11-6 is the registry number for RK-0080552. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-amino-1,2,5-oxadiazol-3-yl)indeno[1,2-e][1,2,4]triazin-9-one (CAS 313527-11-6) is a chemical compound with the molecular formula C12H6N6O2 and a molecular weight of 266.21 g/mol. IUPAC name: 3-(4-amino-1,2,5-oxadiazol-3-yl)indeno[1,2-e][1,2,4]triazin-9-one. InChIKey: KDJJKMFOUNGOLL-UHFFFAOYSA-N.
| Molecular formula | C12H6N6O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 3-(4-amino-1,2,5-oxadiazol-3-yl)indeno[1,2-e][1,2,4]triazin-9-one |
| InChIKey | KDJJKMFOUNGOLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)N=NC(=N3)C4=NON=C4N |
Computed by PubChem (NCBI)