CAS 313527-23-0 appears in our catalog under these names: 5,7-Dihydroimidazo[4',5':4,5]benzo[1,2-d][1,2,3]triazol-6(1h)-one, 95%, 5,7–Dihydroimidazo(4',5':4,5)benzo(1,2–d)(1,2,3)triazol–6(1H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5,7-dihydro-2H-imidazo[4,5-f]benzotriazol-6-one (CAS 313527-23-0) is a chemical compound with the molecular formula C7H5N5O and a molecular weight of 175.15 g/mol. IUPAC name: 5,7-dihydro-2H-imidazo[4,5-f]benzotriazol-6-one. InChIKey: KKBAWAFKLRLXIG-UHFFFAOYSA-N.
| Molecular formula | C7H5N5O |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 5,7-dihydro-2H-imidazo[4,5-f]benzotriazol-6-one |
| InChIKey | KKBAWAFKLRLXIG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC3=NNN=C31)NC(=O)N2 |
Computed by PubChem (NCBI)