CAS 31377-97-6 is the registry number for 1-(4-bromophenyl)-2-((4-methylphenyl)sulfonyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
1-(4-bromophenyl)-2-(4-methylphenyl)sulfonylethanone (CAS 31377-97-6) is a chemical compound with the molecular formula C15H13BrO3S and a molecular weight of 353.2 g/mol. IUPAC name: 1-(4-bromophenyl)-2-(4-methylphenyl)sulfonylethanone. InChIKey: JGMRIHQYBXLTGM-UHFFFAOYSA-N.
| Molecular formula | C15H13BrO3S |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-(4-methylphenyl)sulfonylethanone |
| InChIKey | JGMRIHQYBXLTGM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)