CAS 313953-19-4 appears in our catalog under these names: 5-methoxy-2-methylthieno(2,3-e)(1,3)benzothiazole, 95%, 8-Methoxy-4-methyl-5,12-dithia-3-azatricyclo(7.3.0.0,2,6)dodeca-1(9),2(6),3,7,10-pentaene. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole (CAS 313953-19-4) is a chemical compound with the molecular formula C11H9NOS2 and a molecular weight of 235.3 g/mol. IUPAC name: 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole. InChIKey: YDZZWVSGBXQNGF-UHFFFAOYSA-N.
| Molecular formula | C11H9NOS2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazole |
| InChIKey | YDZZWVSGBXQNGF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C3=C2SC=C3)OC |
Computed by PubChem (NCBI)