Products 313957-41-4

CAS 313957-41-4 is the registry number for PAR-2 antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

N-[3-(benzylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (CAS 313957-41-4) is a chemical compound with the molecular formula C27H22N2O2 and a molecular weight of 406.5 g/mol. IUPAC name: N-[3-(benzylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide. InChIKey: OSTOUXGUSJTQNU-UHFFFAOYSA-N.

Identity
Molecular formulaC27H22N2O2
Molecular weight406.5 g/mol
IUPAC nameN-[3-(benzylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide
InChIKeyOSTOUXGUSJTQNU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC(=O)C(=CC2=CC=CC3=CC=CC=C32)NC(=O)C4=CC=CC=C4

Computed by PubChem (NCBI)

Synonyms: orb2664120