CAS 313957-41-4 is the registry number for PAR-2 antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-(benzylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (CAS 313957-41-4) is a chemical compound with the molecular formula C27H22N2O2 and a molecular weight of 406.5 g/mol. IUPAC name: N-[3-(benzylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide. InChIKey: OSTOUXGUSJTQNU-UHFFFAOYSA-N.
| Molecular formula | C27H22N2O2 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | N-[3-(benzylamino)-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| InChIKey | OSTOUXGUSJTQNU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C(=CC2=CC=CC3=CC=CC=C32)NC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)