CAS 313969-31-2 appears in our catalog under these names: N–Benzhydrylthiophene–2–carboxamide, N-Benzhydrylthiophene-2-carboxamide, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
N-benzhydrylthiophene-2-carboxamide (CAS 313969-31-2) is a chemical compound with the molecular formula C18H15NOS and a molecular weight of 293.4 g/mol. IUPAC name: N-benzhydrylthiophene-2-carboxamide. InChIKey: OQOZVLBAMUXQJI-UHFFFAOYSA-N.
| Molecular formula | C18H15NOS |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | N-benzhydrylthiophene-2-carboxamide |
| InChIKey | OQOZVLBAMUXQJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NC(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)