CAS 314020-70-7 appears in our catalog under these names: (4R)–2–(2–(Diphenylphosphino)phenyl)–4,5–dihydro–4–(phenylmethyl)oxazole, (R)-Bn-Phox 98%, (R)-4-benzyl-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole, 98%, 98%, (R)-Bn-Phox, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 200mg, 5g, 50mg, 250mg, 1g.
[2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (CAS 314020-70-7) is a chemical compound with the molecular formula C28H24NOP and a molecular weight of 421.5 g/mol. IUPAC name: [2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane. InChIKey: PXKBZZCPBWBSKT-HSZRJFAPSA-N.
| Molecular formula | C28H24NOP |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | [2-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| InChIKey | PXKBZZCPBWBSKT-HSZRJFAPSA-N |
| SMILES | C1[C@H](N=C(O1)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)