CAS 314045-98-2 is the registry number for 3,6-Dichloro-N-isopropylbenzo[b]thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dichloro-N-propan-2-yl-1-benzothiophene-2-carboxamide (CAS 314045-98-2) is a chemical compound with the molecular formula C12H11Cl2NOS and a molecular weight of 288.2 g/mol. IUPAC name: 3,6-dichloro-N-propan-2-yl-1-benzothiophene-2-carboxamide. InChIKey: XGXOMKGEHDVDNU-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NOS |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | 3,6-dichloro-N-propan-2-yl-1-benzothiophene-2-carboxamide |
| InChIKey | XGXOMKGEHDVDNU-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=C(C2=C(S1)C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)