CAS 314279-41-9 is the registry number for 4-((4-(5-Methylbenzo[d]thiazol-2-yl)phenyl)amino)-4-oxobut-2-enoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[4-(5-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoic acid (CAS 314279-41-9) is a chemical compound with the molecular formula C18H14N2O3S and a molecular weight of 338.4 g/mol. IUPAC name: (E)-4-[4-(5-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoic acid. InChIKey: PEXIQNCFSAYDOH-CMDGGOBGSA-N.
| Molecular formula | C18H14N2O3S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (E)-4-[4-(5-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoic acid |
| InChIKey | PEXIQNCFSAYDOH-CMDGGOBGSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=N2)C3=CC=C(C=C3)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)