CAS 314284-36-1 is the registry number for Anticancer agent 252. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-chloro-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone (CAS 314284-36-1) is a chemical compound with the molecular formula C17H16ClN3O3 and a molecular weight of 345.8 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone. InChIKey: XWLKCYUAGDQDCP-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3O3 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)-(4-phenylpiperazin-1-yl)methanone |
| InChIKey | XWLKCYUAGDQDCP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)C(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)