CAS 31431-18-2 is the registry number for (4-Chloro-3-nitrophenyl)-(2-thienyl)methanone. Offered by: TRC. Available pack sizes: 10g, 1g.
(4-chloro-3-nitrophenyl)-thiophen-2-ylmethanone (CAS 31431-18-2) is a chemical compound with the molecular formula C11H6ClNO3S and a molecular weight of 267.69 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)-thiophen-2-ylmethanone. InChIKey: OELFHUHQZUESIQ-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO3S |
|---|---|
| Molecular weight | 267.69 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)-thiophen-2-ylmethanone |
| InChIKey | OELFHUHQZUESIQ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)